Home
Products
(+)-Corynoline
| Product Name | (+)-Corynoline |
| Price: | $66 / 20mg |
| Catalog No.: | CN02159 |
| CAS No.: | 18797-79-0 |
| Molecular Formula: | C21H21NO5 |
| Molecular Weight: | 367.40 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The tubers of Corydalis ambigua |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CN1Cc2c3OCOc3ccc2[C@@]2([C@H]1c1cc3OCOc3cc1C[C@@H]2O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Corynoline, isolated from Corydalis incise (Papaveraceae), is a reversible and noncompetitive acetylcholinesterase (AChE) inhibitor with an IC50 of 30.6 μM[1]. Corynoline exhibits anti-inflammatory activity by activating Nrf2[2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 504.2±50.0 °C at 760 mmHg |
| Flash Point | 258.7±30.1 °C |
| Exact Mass | 367.141968 |
| PSA | 60.39000 |
| LogP | 3.23 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |