Home
Products
Acetylcorynoline
| Product Name | Acetylcorynoline |
| Price: | $117 / 20mg |
| Catalog No.: | CN02156 |
| CAS No.: | 18797-80-3 |
| Molecular Formula: | C23H23NO6 |
| Molecular Weight: | 409.43 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The tubers of Corydalis ambigua |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OC1Cc2cc3OCOc3cc2C2C1(C)c1ccc3c(c1CN2C)OCO3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Acetylcorynoline is the major alkaloid component derived from Corydalis bungeana, and has anti-inflammatory properties[1]. |
| In Vitro | Acetylcorynoline significantly inhibits the secretion of tumor necrosis factor-α, interleukin-6, and interleukin-12p70 by LPS-stimulated Dendritic cells (DCs)[1]. Acetylcorynoline significantly inhibits LPS-induced activation of IκB kinase and mitogen-activated protein kinase[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 499.1±45.0 °C at 760 mmHg |
| Flash Point | 255.7±28.7 °C |
| Exact Mass | 409.152527 |
| PSA | 66.46000 |
| LogP | 4.05 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | 2-8C |