Home
Products
Alisol B acetate
| Product Name | Alisol B acetate |
| Price: | Inquiry |
| Catalog No.: | CN07840 |
| CAS No.: | 19865-76-0 |
| Molecular Formula: | C32H50O5 |
| Molecular Weight: | 514.74 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Cryst. |
| Source: | The tubers of Alisma plantago-aquatica Linn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@H](C(=O)C(C)C)C[C@H](C1=C2C[C@H](O)[C@@H]3[C@]([C@]2(CC1)C)(C)CC[C@@H]1[C@]3(C)CCC(=O)C1(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Exact Mass | 514.36600 |
| PSA | 76.13000 |
| LogP | 6.41090 |