Home
Products
Diosmetin-7-O-beta-D-glucopyranoside
| Product Name | Diosmetin-7-O-beta-D-glucopyranoside |
| Price: | $62 / 10mg |
| Catalog No.: | CN05404 |
| CAS No.: | 20126-59-4 |
| Molecular Formula: | C22H22O11 |
| Molecular Weight: | 462.41 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The flowers of Chrysanthemum morifolium |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)c3c(c2)oc(cc3=O)c2ccc(c(c2)O)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Diosmetin-7-O-β-D-glucopyranoside is a natural product isolated from the flowers of Chrysanthemum morifolium, with antioxidant activity[1][2]. |
| Density | 1.609 |
| Boiling Point | 803.6±65.0 °C at 760 mmHg |
| Flash Point | 281.7±27.8 °C |
| Exact Mass | 462.116211 |
| PSA | 179.28000 |
| LogP | 0.61 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Storage condition | -20C |