Home
Products
Rutundic acid
| Product Name | Rutundic acid |
| Price: | $117 / 10mg |
| Catalog No.: | CN07944 |
| CAS No.: | 20137-37-5 |
| Molecular Formula: | C30H48O5 |
| Molecular Weight: | 488.71 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The leaves of Ilex pubescens Hook. et Arn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCC1(C)C(O)CCC2(C1CCC1(C2CC=C2C1(C)CCC1(C2C(C)(O)C(CC1)C)C(=O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rotundic acid, a triterpenoid obtained from I. rotunda, induces DNA damage and cell apoptosis in hepatocellular carcinoma through AKT/mTOR and MAPK Pathways. Rotundic acid possesses anti-inflammatory and cardio-protective abilities[1]. |
| Target | Akt mTOR p38 MAPK |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 622.8±55.0 °C at 760 mmHg |
| Flash Point | 344.5±28.0 °C |
| Exact Mass | 488.350189 |
| PSA | 97.99000 |
| LogP | 5.75 |
| Vapour Pressure | 0.0±4.1 mmHg at 25°C |
| Storage condition | -20℃ |