Home
Products
Tenuifolin
| Product Name | Tenuifolin |
| Price: | $83 / 20mg |
| Catalog No.: | CN07974 |
| CAS No.: | 20183-47-5 |
| Molecular Formula: | C36H56O12 |
| Molecular Weight: | 680.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The roots of Polygala tenuifolia Willd. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2C(O)CC3(C(C2(C)C(=O)O)CCC2(C3CC=C3C2(CO)CCC2(C3CC(C)(C)CC2)C(=O)O)C)C)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tenuifolin is a triterpene isolated from Polygala tenuifolia Willd, has neuroprotective effects. Tenuifolin reduces Aβ secretion by inhibiting β-secretase. Tenuifolin improves learning and memory in aged mice by decreasing AChE activity and has the potential for Alzheimer’s disease (AD) treatment[1]. |
| Target | IC50: β-secretase; ACHE[1] |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 853.6±65.0 °C at 760 mmHg |
| Flash Point | 262.2±27.8 °C |
| Exact Mass | 680.377197 |
| PSA | 214.44000 |
| LogP | 2.25 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |