Home
Products
13(18)-Oleanen-3-one
| Product Name | 13(18)-Oleanen-3-one |
| Price: | Inquiry |
| Catalog No.: | CN08044 |
| CAS No.: | 20248-08-2 |
| Molecular Formula: | C30H48O |
| Molecular Weight: | 424.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Cryst. |
| Source: | The herbs of Euphorbia supina |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CCC2=C3CC(C)(C)CC[C@@]3(CC[C@@]12C)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | δ-Amyrenone (Delta-Amyrone) is a pentacyclic triterpene compound from S. lineare, with anti-inflammatory effects[1]. |
| In Vivo | δ-Amyrone (4 mg/kg and 8 mg/kg; i.p.) inhibits lipopolysaccharide-induced inflammatory cytokines and protects against endotoxic shock in mice[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 488.8±44.0 °C at 760 mmHg |
| Flash Point | 203.1±23.4 °C |
| Exact Mass | 424.370514 |
| PSA | 17.07000 |
| LogP | 10.51 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |