Home
Products
3,7-Di-O-methylquercetin
| Product Name | 3,7-Di-O-methylquercetin |
| Price: | $180 / 10mg |
| Catalog No.: | CN04795 |
| CAS No.: | 2068-02-2 |
| Molecular Formula: | C17H14O7 |
| Molecular Weight: | 330.289 |
| Purity: | ≥98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Passiflora foetida L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c2c(c1)oc(c(c2=O)OC)c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Quercetin 3,7-dimethyl ether， isolated from Croton schiedeanus Schlecht，has a NO/cGMP pathway-related profile, with increased vasorelaxant activity[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 631.5±55.0 °C at 760 mmHg |
| Flash Point | 236.8±25.0 °C |
| Exact Mass | 330.073944 |
| PSA | 109.36000 |
| LogP | 2.59 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |