Home
Products
Beta-mangostin
| Product Name | Beta-mangostin |
| Price: | $146 / 5mg |
| Catalog No.: | CN05844 |
| CAS No.: | 20931-37-7 |
| Molecular Formula: | C25H28O6 |
| Molecular Weight: | 424.49 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Yellow powder |
| Source: | The fruits of Garcinia mangostana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(O)cc2c(c1CC=C(C)C)c(=O)c1c(o2)cc(c(c1O)CC=C(C)C)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | beta-Mangostin is a natural product. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 616.5±55.0 °C at 760 mmHg |
| Flash Point | 208.3±25.0 °C |
| Exact Mass | 424.188599 |
| PSA | 89.13000 |
| LogP | 6.02 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Storage condition | -20°C |