Home
Products
Taraxeryl acetate
| Product Name | Taraxeryl acetate |
| Price: | Inquiry |
| Catalog No.: | CN08016 |
| CAS No.: | 2189-80-2 |
| Molecular Formula: | C32H52O2 |
| Molecular Weight: | 468.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Taraxacum mongolicum Hand. Mazz. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OC1CCC2(C(C1(C)C)CCC1(C2CCC2(C1=CCC1(C2CC(C)(C)CC1)C)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Taraxerol acetate is a COX-1 and COX-2 inhibitor with IC50 values of 116.3 μM and 94.7 μM, respectively. Taraxerol acetate the has the anticancer potential and induces cell apoptosis[1]. |
| Target | COX-1:116.3 μM (IC50) COX-2:94.7 μM (IC50) |
| In Vitro | Taraxerol acetate(10-150 µM; 24 or 48 hours) induces a dose- and time-dependent cytotoxic effects in the U87 cells, exhibits IC50 values of 34.2 and 28.4 µM, at 24 and 48 h, respectively[2]. Taraxerol acetate(10, 50 and 150 µM; 24 hours) induces cell apoptosis, the percentage of apoptotic cells increased from 7.3% in the control cells, to 16.1, 44.1 and in the 10, 50 and 150 µM taraxerol acetate-treated cells, respectively. Furthermore, taraxerol acetate treatment led to sub-G1 cell cycle arrest with a corresponding decrease in the number of S-phase cells[2]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 505.1±49.0 °C at 760 mmHg |
| Flash Point | 256.2±17.4 °C |
| Exact Mass | 468.396729 |
| PSA | 26.30000 |
| LogP | 11.95 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |