Home
Products
3'-Methoxydaidzein
| Product Name | 3'-Methoxydaidzein |
| Price: | Inquiry |
| Catalog No.: | CN04849 |
| CAS No.: | 21913-98-4 |
| Molecular Formula: | C16H12O5 |
| Molecular Weight: | 284.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Derris robusta |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(ccc1O)c1coc2c(c1=O)ccc(c2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3'-Methoxydaidzein is a isoflavone and a Sodium Channel inhibitor. 3'-Methoxydaidzein inhibits subtypes NaV1.7, NaV1.8 and NaV1.3 with IC50 of 181 nM, 397 nM, and 505 nM, respectively. 3'-Methoxydaidzein exerts analgesic activity by inhibiting voltage-gated sodium channels[1]. |
| Target | Nav1.3:505 nM (IC50) Nav1.7:181 nM (IC50) Nav1.8:397 nM (IC50) |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 534.5±50.0 °C at 760 mmHg |
| Flash Point | 204.8±23.6 °C |
| Exact Mass | 284.068481 |
| PSA | 79.90000 |
| LogP | 2.54 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |