Home
Products
Loganic acid
| Product Name | Loganic acid |
| Price: | $46 / 20mg |
| Catalog No.: | CN03166 |
| CAS No.: | 22255-40-9 |
| Molecular Formula: | C16H24O10 |
| Molecular Weight: | 376.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The roots of Gentiana macrophylla Pall. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C([C@@H]3[C@H]2[C@@H](C)[C@H](C3)O)C(=O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Loganic acid is an iridoid isolated from cornelian cherry fruits. Loganic acid can modulate diet-induced atherosclerosis and redox status. Loganic acid has strong free radical scavenging activity and remarkable cyto-protective effect against heavy metal mediated toxicity[1][2]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 646.3±55.0 °C at 760 mmHg |
| Flash Point | 235.6±25.0 °C |
| Exact Mass | 376.136932 |
| PSA | 166.14000 |
| LogP | -2.49 |
| Vapour Pressure | 0.0±4.4 mmHg at 25°C |