Home
Products
Ardisiacrispin A
| Product Name | Ardisiacrispin A |
| Price: | $146 / 10mg |
| Catalog No.: | CN07823 |
| CAS No.: | 23643-61-0 |
| Molecular Formula: | C52H84O22 |
| Molecular Weight: | 1061.21 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The herbs of Ardisia crenata. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2C(OCC(C2O)OC2OC(CO)C(C(C2OC2OCC(C(C2O)O)O)O)O)OC2CCC3(C(C2(C)C)CCC2(C3CCC34C2(C)CC(C2(C4CC(C)(C=O)CC2)CO3)O)C)C)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ardisiacrispin A (Deglucocyclamin) is a common triterpenoid saponin from Ardisia species. Ardisiacrispin A has similar biological properties with some triterpenoid saponins in A. crenata which is one of the species of genus Ardisia and exhibits cytotoxic effect on tumor cells, immunomodulatory and antiviral activities[1]. |
| Density | 1.48±0.1 g/cm3 (20 ºC 760 Torr) |
| Exact Mass | 1060.545410 |
| PSA | 342.90000 |
| LogP | 3.78 |
| Storage condition | 2-8℃ |