Home
Products
Senegenin
| Product Name | Senegenin |
| Price: | $92 / 20mg |
| Catalog No.: | CN08130 |
| CAS No.: | 2469-34-3 |
| Molecular Formula: | C30H45ClO6 |
| Molecular Weight: | 537.14 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Polygala tenuifolia Willd. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | ClC[C@H]1C[C@H]2[C@@](C3=C1[C@H]1CC(C)(C)CC[C@@]1(CC3)C(=O)O)(C)CCC1[C@]2(C)C[C@H](O)[C@@H]([C@]1(C)C(=O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tenuigenin is a major active component isolated from the root of the Chinese herb Polygala tenuifolia. Tenuigenin protects against S.aureus-induced pneumonia by inhibiting NF-κB activation. Tenuigenin has anti-inflammatory effect[1]. |
| Target | NF-κB |
| In Vivo | Tenuigenin (2, 4, 8 mg/kg) significantly attenuates S.aureus-induced lung histopathological changes. Tenuigenin also inhibits lung wet/dry (W/D) ratio, and inflammatory cytokines TNF-α and IL-1β production in Male BALB/c mice[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 674.1±55.0 °C at 760 mmHg |
| Flash Point | 361.5±31.5 °C |
| Exact Mass | 536.290466 |
| PSA | 115.06000 |
| LogP | 6.39 |
| Vapour Pressure | 0.0±4.7 mmHg at 25°C |
| Storage condition | 2-8C |