Home
Products
Cimiracemoside C
| Product Name | Cimiracemoside C |
| Price: | Inquiry |
| Catalog No.: | CN07986 |
| CAS No.: | 256925-92-5 |
| Molecular Formula: | C35H56O9 |
| Molecular Weight: | 620.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Cimicifuga foetida L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@H]1[C@@H](O)CO[C@H]([C@@H]1O)O[C@H]1CC[C@]23[C@H](C1(C)C)CC[C@@H]1[C@@]3(C2)CC[C@]2([C@@]1(C)[C@@H](O)[C@@]13[C@@H]2[C@H](C)C[C@@H](O1)[C@H](O3)C(O)(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cimiracemoside C is an active component of Cimicifuga racemosa, activates AMPK, has the potential activity against diabetes[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 740.3±60.0 °C at 760 mmHg |
| Flash Point | 401.5±32.9 °C |
| Exact Mass | 620.392456 |
| PSA | 138.07000 |
| LogP | 5.82 |
| Vapour Pressure | 0.0±5.5 mmHg at 25°C |