Home
Products
Physcion 1-O-beta-D-glucoside
| Product Name | Physcion 1-O-beta-D-glucoside |
| Price: | $439 / 5mg |
| Catalog No.: | CN05934 |
| CAS No.: | 26296-54-8 |
| Molecular Formula: | C22H22O10 |
| Molecular Weight: | 446.41 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Powder |
| Source: | The roots and rhizomes of Rheum palmatum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(C)cc3c2C(=O)c2c(C3=O)cc(cc2O)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Physion 8-O-β-D-glucoside is a bioactive component of Fallopia multiflora, can be used for the research of dizziness[1]. |
| Density | 1.567±0.06 g/cm3 (20 ºC 760 Torr) |
| Boiling Point | 796.3±60.0 °C at 760 mmHg |
| Flash Point | 280.3±26.4 °C |
| Exact Mass | 446.121307 |
| PSA | 162.98000 |
| LogP | 1.72 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Storage condition | 2-8℃ |