Home
Products
Alisol C monoacetate
| Product Name | Alisol C monoacetate |
| Price: | $62 / 10mg |
| Catalog No.: | CN07815 |
| CAS No.: | 26575-93-9 |
| Molecular Formula: | C32H48O6 |
| Molecular Weight: | 528.73 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The tubers of Alisma plantago-aquatica Linn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@H]([C@H]1OC1(C)C)C[C@H](C1=C2C[C@H](O)[C@@H]3[C@]([C@]2(CC1=O)C)(C)CC[C@@H]1[C@]3(C)CCC(=O)C1(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Alisol C 23-acetate, a natural product extracted from Alisma orientale, can significantly and strongly inhibit DTH response after oral administration. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 624.9±55.0 °C at 760 mmHg |
| Flash Point | 192.9±25.0 °C |
| Exact Mass | 528.345093 |
| PSA | 93.20000 |
| LogP | 3.60 |
| Vapour Pressure | 0.0±4.1 mmHg at 25°C |
| Storage condition | 2-8℃ |