Home
Products
Cimigenoside
| Product Name | Cimigenoside |
| Price: | $204 / 10mg |
| Catalog No.: | CN07972 |
| CAS No.: | 27994-11-2 |
| Molecular Formula: | C35H56O9 |
| Molecular Weight: | 620.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Cimicifuga foetida L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC1C(O)COC(C1O)OC1CCC23C(C1(C)C)CCC1C3(C2)CCC2(C1(C)C(O)C13C2C(C)CC(O1)C(O3)C(O)(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cimigenoside is an active compound from genus Cimicifuga[1]. |
| Density | 1.4±0.1 g/cm3 |
| Exact Mass | 616.361145 |
| PSA | 138.07000 |
| LogP | 6.30 |
| Storage condition | 2-8C |