Home
Products
Pluviatolide
| Product Name | Pluviatolide |
| Price: | Inquiry |
| Catalog No.: | CN02883 |
| CAS No.: | 28115-68-6 |
| Molecular Formula: | C20H20O6 |
| Molecular Weight: | 356.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The herbs of Macaranga tanarius |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(ccc1O)C[C@H]1C(=O)OC[C@@H]1Cc1ccc2c(c1)OCO2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pluviatolide ((-)-Pluviatolide) is a lignan that can be found in the bark of Zanthoxylum pluviatile Hartley. Pluviatolide can be used as (-)-Podophyllotoxin precursor[1][2]. |
| Exact Mass | 356.12600 |
| PSA | 74.22000 |
| LogP | 2.70390 |