Home
Products
Beta-Elemonic acid
| Product Name | Beta-Elemonic acid |
| Price: | $69 / 10mg |
| Catalog No.: | CN07511 |
| CAS No.: | 28282-25-9 |
| Molecular Formula: | C30H46O3 |
| Molecular Weight: | 454.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The sclerotium of Poria cocos (Schw.) Wolf |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCC[C@@H]([C@@H]1CC[C@]2([C@@]1(C)CCC1=C2CC[C@@H]2[C@]1(C)CCC(=O)C2(C)C)C)C(=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | β-Elemonic acid is a triterpene isolated from Boswellia papyrifera. β-Elemonic acid induces cell apoptosis, reactive oxygen species (ROS) and COX-2 expression and inhibits prolyl endopeptidase. β-Elemonic acid exhibits anticancer and anti-inflammatory effects[1][2]. |
| Target | COX-2 |
| In Vitro | β-elemonic acid (1, 3, 10, 20 µM; 24 hours) strongly induces human A549 lung cancer cell apoptosis in a dose- and time-dependent manner[1]. β-elemonic acid (1, 3, 10, 20 µM; 24 hours) exerts potent cytotoxic effects on human NSCLC A549 cells in a dose-dependent manner. The IC50 value following a 24-h exposure to β-elemonic acid was 6.92 µM[1]. β-elemonic acid (20 µM; 24 hours) results in a cell percentage of 58.01% in the G0/G1 phase[1]. β-elemonic acid (1, 3, 10, 20 µM; 24 hours) inhibits phosphorylation of p42/44, MAPK/JNK and p38 in the A549 cells[1]. |
| Density | 1.07 |
| Boiling Point | 565.2±50.0 °C at 760 mmHg |
| Flash Point | 309.6±26.6 °C |
| Exact Mass | 454.344696 |
| PSA | 54.37000 |
| LogP | 8.56 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Storage condition | -20℃ |