Home
Products
Lithospermic acid
| Product Name | Lithospermic acid |
| Price: | $65 / 20mg |
| Catalog No.: | CN06961 |
| CAS No.: | 28831-65-4 |
| Molecular Formula: | C27H22O12 |
| Molecular Weight: | 538.46 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The roots of Lithospermum ruderale |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(O[C@@H](C(=O)O)Cc1ccc(c(c1)O)O)/C=C/c1ccc(c2c1[C@H](C(=O)O)[C@H](O2)c1ccc(c(c1)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lithospermic acid ((+)-Lithospermic acid) is a plant-derived polycyclic phenolic carboxylic acid isolated from Salvia miltiorrhiza, and has the anti-oxidative and hepatoprotective activity on carbon tetrachloride (CCl4)-induced acute liver damage in vitro and in vivo[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 862.6±65.0 °C at 760 mmHg |
| Flash Point | 291.3±27.8 °C |
| Exact Mass | 538.111145 |
| PSA | 211.28000 |
| LogP | 1.45 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8C |