Home
Products
6-Methoxyflavanone
| Product Name | 6-Methoxyflavanone |
| Price: | Inquiry |
| Catalog No.: | CN04389 |
| CAS No.: | 3034-04-6 |
| Molecular Formula: | C16H14O3 |
| Molecular Weight: | 254.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The culture metabolites of Isaria fumosorosea KCH J2. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1)C(=O)CC(O2)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.199g/cm3 |
| Boiling Point | 425.5ºC at 760mmHg |
| Flash Point | 202.9ºC |
| Exact Mass | 254.09400 |
| PSA | 35.53000 |
| LogP | 3.40170 |