Home
Products
Tetrahydrocannabivarin
| Product Name | Tetrahydrocannabivarin |
| Price: | Inquiry |
| Catalog No.: | CN03666 |
| CAS No.: | 31262-37-0 |
| Molecular Formula: | C19H26O2 |
| Molecular Weight: | 286.41 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The seeds of Cannabis sativa L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCc1cc(O)c2c(c1)OC([C@H]1[C@H]2C=C(C)CC1)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 360.6±42.0 °C at 760 mmHg |
| Flash Point | 137.6±22.1 °C |
| Exact Mass | 286.193268 |
| PSA | 29.46000 |
| LogP | 6.62 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |