Home
Products
Kaempferol 3-neohesperidoside
| Product Name | Kaempferol 3-neohesperidoside |
| Price: | $146 / 20mg |
| Catalog No.: | CN05409 |
| CAS No.: | 32602-81-6 |
| Molecular Formula: | C27H30O15 |
| Molecular Weight: | 594.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Delphinium grandiflorum L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2c(oc3c(c2=O)c(O)cc(c3)O)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kaempferol 3-neohesperidoside (Kaempferol 3-O-neohesperidoside) is a flavonoid isolated from the leaf extract of P. latifolia and P. vulgaris[1]. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 945.5±65.0 °C at 760 mmHg |
| Flash Point | 314.1±27.8 °C |
| Exact Mass | 594.158447 |
| PSA | 249.20000 |
| LogP | 2.66 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |