Home
Products
Panaxatriol
| Product Name | Panaxatriol |
| Price: | $18 / 20mg |
| Catalog No.: | CN08022 |
| CAS No.: | 32791-84-7 |
| Molecular Formula: | C30H52O4 |
| Molecular Weight: | 476.73 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The roots of Panax ginseng C. A. Mey. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC1CC2(C)C(C3(C1C(C)(C)C(O)CC3)C)CC(C1C2(C)CCC1C1(C)CCCC(O1)(C)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Panaxatriol is a natural product that can relieve myelosuppression induced by radiation injury. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 561.5±50.0 °C at 760 mmHg |
| Flash Point | 293.4±30.1 °C |
| Exact Mass | 476.386566 |
| PSA | 69.92000 |
| LogP | 5.94 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Storage condition | -20°C |