Home
Products
Araloside V
| Product Name | Araloside V |
| Price: | $234 / 10mg |
| Catalog No.: | CN07775 |
| CAS No.: | 340963-86-2 |
| Molecular Formula: | C54H88O23 |
| Molecular Weight: | 1105.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Aralia elata |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3CC(C)(C)CC2)C(=O)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)C)C)[C@@H]([C@H]([C@@H]1O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Araloside V (Congmunoside V) is a triterpenoid saponin isolated from Aralia elata[1]. |
| Density | 1.5±0.1 g/cm3 |
| Exact Mass | 1104.571655 |
| PSA | 374.13000 |
| LogP | 3.47 |
| Storage condition | 2-8C |