Home
Products
20(R)-Ginsenoside Rg3
| Product Name | 20(R)-Ginsenoside Rg3 |
| Price: | Inquiry |
| Catalog No.: | CN07965 |
| CAS No.: | 38243-03-7 |
| Molecular Formula: | C42H72O13 |
| Molecular Weight: | 785.02 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | White powder |
| Source: | The roots of Panax ginseng C. A. Mey. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OC2CCC3(C(C2(C)C)CCC2(C3CC(O)C3C2(C)CCC3C(CCC=C(C)C)(O)C)C)C)C(C(C1O)O)OC1OC(CO)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 20(R)-ginsenoside Rg3 (20(R)-Propanaxadiol), one of the active compounds present in ginseng root, has a potent angiosuppressive and antitumor activities[1][2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 1117.1±65.0 °C at 760 mmHg |
| Flash Point | 629.4±34.3 °C |
| Exact Mass | 1078.592407 |
| PSA | 357.06000 |
| LogP | 4.73 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |