Home
Products
Groenlandicine
| Product Name | Groenlandicine |
| Price: | $146 / 5mg |
| Catalog No.: | CN00785 |
| CAS No.: | 38691-95-1 |
| Molecular Formula: | C19H16NO4 |
| Molecular Weight: | 322.10 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Coptis groenlandica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2c(cc1O)CC[n+]1c2cc2ccc3c(c2c1)OCO3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Groenlandicine is a protoberberine alkaloid isolated from Coptidis Rhizoma. Groenlandicine exhibits moderate inhibitory effect with IC50 value of 154.2 μM for human recombinant aldose reductase (HRAR)[1]. Groenlandicine selectively induces topoisomerase I-mediated DNA cleavage[2]. |
| Target | Topoisomerase I |
| Exact Mass | 321.10000 |
| PSA | 48.64000 |
| LogP | 1.44980 |
| Storage condition | 2-8℃ |