Home
Products
Cucurbitacin D
| Product Name | Cucurbitacin D |
| Price: | $249 / 10mg |
| Catalog No.: | CN07814 |
| CAS No.: | 3877-86-9 |
| Molecular Formula: | C30H44O7 |
| Molecular Weight: | 516.67 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Hemsleya amabilis Diels. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1C[C@@H]2C(=CC[C@@H]3[C@@]2(C)C(=O)C[C@]2([C@@]3(C)C[C@H]([C@@H]2[C@](C(=O)/C=C/C(O)(C)C)(O)C)O)C)C(C1=O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cucurbitacin D is an active component in Cucurbita texana, disrupts interactions between Hsp90 and two co-chaperones, Cdc37 and p23. Cucurbitacin D prevents Hsp90 client (Her2, Raf, Cdk6, pAkt) maturation without induction of the heat shock response. Anti-cancer activity[1]. |
| Target | HSP90 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 684.0±55.0 °C at 760 mmHg |
| Flash Point | 381.4±28.0 °C |
| Exact Mass | 516.308716 |
| PSA | 132.13000 |
| LogP | 1.48 |
| Vapour Pressure | 0.0±4.8 mmHg at 25°C |