Home
Products
Eriodictyol-7-O-glucoside
| Product Name | Eriodictyol-7-O-glucoside |
| Price: | $467 / 10mg |
| Catalog No.: | CN04980 |
| CAS No.: | 38965-51-4 |
| Molecular Formula: | C21H22O11 |
| Molecular Weight: | 450.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Dracocephalum rupestre |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2cc3OC(CC(=O)c3c(c2)O)c2ccc(c(c2)O)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Eriodictyol-7-O-glucoside (Eriodictyol 7-O-β-D-glucoside), a flavonoid, is a potent free radical scavenger. Eriodictyol-7-O-glucoside is also an Nrf2 activator, confers protection against Cisplatin-induced toxicity[1]. |
| Target | Nrf2[1] |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 841.0±65.0 °C at 760 mmHg |
| Flash Point | 296.9±27.8 °C |
| Exact Mass | 450.116211 |
| PSA | 186.37000 |
| LogP | 0.22 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Storage condition | 2-8°C |