Home
Products
Iristectorigenin A
| Product Name | Iristectorigenin A |
| Price: | $351 / 10mg |
| Catalog No.: | CN04239 |
| CAS No.: | 39012-01-6 |
| Molecular Formula: | C17H14O7 |
| Molecular Weight: | 330.29 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Belamcanda chinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(ccc1O)c1coc2c(c1=O)c(O)c(c(c2)O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Iristectorigenin A is a natural isoflavone isolated from B. chinensis rhizomes. Iristectorigenin A shows antioxidant activity[1][2]. |
| Density | 1.483g/cm3 |
| Boiling Point | 619ºC at 760 mmHg |
| Flash Point | 232ºC |
| Exact Mass | 330.07400 |
| PSA | 109.36000 |
| LogP | 2.59400 |
| Storage condition | 2-8℃ |