Home
Products
Yatein
| Product Name | Yatein |
| Price: | Inquiry |
| Catalog No.: | CN02942 |
| CAS No.: | 40456-50-6 |
| Molecular Formula: | C22H24O7 |
| Molecular Weight: | 400.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Oil |
| Source: | The leaves of Chamaecyparis obtusa |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(C[C@H]2C(=O)OC[C@@H]2Cc2ccc3c(c2)OCO3)cc(c1OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Yatein is a lignan isolated from A. chilensis, with antiproliferative activity[1]. Yatein suppresses herpes simplex virus type 1 (HSV-1 ) replication by interruption the immediate-early gene expression[2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 564.9±45.0 °C at 760 mmHg |
| Flash Point | 246.2±28.8 °C |
| Exact Mass | 400.152191 |
| PSA | 72.45000 |
| LogP | 3.06 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |