Home
Products
Pedunculoside
| Product Name | Pedunculoside |
| Price: | $37 / 20mg |
| Catalog No.: | CN08093 |
| CAS No.: | 42719-32-4 |
| Molecular Formula: | C36H58O10 |
| Molecular Weight: | 650.84 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The barks of Ilex rotunda Thunb. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC(=O)[C@@]23CC[C@H]([C@@]([C@H]3C3=CC[C@H]4[C@@]([C@@]3(CC2)C)(C)CC[C@@H]2[C@]4(C)CC[C@@H]([C@@]2(C)CO)O)(C)O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pedunculoside is a main bioactive component isolated from Jiubiying. Pedunculoside exerts lipid-lowering effects partly through the regulation of lipogenesis and fatty acid β-oxidation[1]. |
| In Vitro | Pedunculoside is a triterpene saponin extracted from Ilex rotunda Thunb. Pedunculoside regulates PPAR-γ, CCAAT/Enhancer-binding Protein α(C/EBPα)、and SREBP-1 expression as well as inhibited phosphorylation of AMPK in MDI (methylisobutylxanthine, dexamethasone, insulin) induced-3T3L1 cells[1]. |
| Density | 1.31 |
| Boiling Point | 760.1±60.0 °C at 760 mmHg |
| Flash Point | 230.3±26.4 °C |
| Exact Mass | 650.403015 |
| PSA | 177.14000 |
| LogP | 5.01 |
| Vapour Pressure | 0.0±5.8 mmHg at 25°C |