Home
Products
Magnoflorine Iodide
| Product Name | Magnoflorine Iodide |
| Price: | $146 / 20mg |
| Catalog No.: | CN01039 |
| CAS No.: | 4277-43-4 |
| Molecular Formula: | C20H24NO4.I |
| Molecular Weight: | 469.31 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The flowers of Magnolia liliiflora Desr. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2CC[N+]([C@@H]3c2c(c1[O-])c1c(C3)ccc(c1O)OC)(C)C.I |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (+)-Magnoflorine iodide (Magnoflorine iodide), an aporphine alkaloid found in Acoruscalamus, reduces the formation of C. albicans biofilm[1]. (+)-Magnoflorine iodide has anti-fungal, anti-antidiabetic and anti-oxidative activity[2]. |
| Exact Mass | 469.07500 |
| PSA | 58.92000 |
| Storage condition | 2-8C |