Home
Products
3-O-Acetyloleanolic acid
| Product Name | 3-O-Acetyloleanolic acid |
| Price: | $146 / 10mg |
| Catalog No.: | CN07939 |
| CAS No.: | 4339-72-4 |
| Molecular Formula: | C32H50O4 |
| Molecular Weight: | 498.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Phytolacca americana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2CC(C)(C)CC1)C(=O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3-O-Acetyloleanolic acid (3AOA), an oleanolic acid derivative isolated from the seeds of Vigna sinensis K., induces in cancer and also exhibits anti-angiogenesis activity[1]. |
| Target | Apoptosis[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 564.4±50.0 °C at 760 mmHg |
| Flash Point | 170.4±23.6 °C |
| Exact Mass | 498.370911 |
| PSA | 63.60000 |
| LogP | 9.95 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |