Home
Products
Asiatic acid
| Product Name | Asiatic acid |
| Price: | $28 / 20mg |
| Catalog No.: | CN07935 |
| CAS No.: | 464-92-6 |
| Molecular Formula: | C30H48O5 |
| Molecular Weight: | 488.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Centella asiatica. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@]1(C)[C@@H](O)[C@H](O)C[C@]2([C@H]1CC[C@@]1(C2CC=C2[C@@]1(C)CC[C@@]1([C@H]2[C@@H](C)[C@@H](CC1)C)C(=O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Asiatic acid, a pentacyclic triterpene found in Centella asiatica, induces apoptosis in melanoma cells. Asiatic acid can be used to treat skin cancer[1]. Asiatic acid also has anti-inflammatory activities[2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 609.4±55.0 °C at 760 mmHg |
| Flash Point | 336.4±28.0 °C |
| Exact Mass | 488.350189 |
| PSA | 97.99000 |
| LogP | 6.46 |
| Vapour Pressure | 0.0±4.0 mmHg at 25°C |
| Storage condition | 2-8°C |