Home
Products
alpha-Lapachone
| Product Name | alpha-Lapachone |
| Price: | Inquiry |
| Catalog No.: | CN05905 |
| CAS No.: | 4707-33-9 |
| Molecular Formula: | C15H14O3 |
| Molecular Weight: | 242.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Quinones |
| Physical Desc.: | Yellow powder |
| Source: | The barks of Catalpa ovata. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1C2=C(CCC(O2)(C)C)C(=O)c2c1cccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | α-Lapachone shows trypanocidal activity[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 372.9±42.0 °C at 760 mmHg |
| Flash Point | 165.5±27.9 °C |
| Exact Mass | 242.094299 |
| PSA | 43.37000 |
| LogP | 3.13 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |