Home
Products
Linarin
| Product Name | Linarin |
| Price: | $51 / 20mg |
| Catalog No.: | CN05355 |
| CAS No.: | 480-36-4 |
| Molecular Formula: | C28H32O14 |
| Molecular Weight: | 592.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Uncaria sinensis (Oliv.) Havil. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1ccc(cc1)c1cc(=O)c2c(o1)cc(cc2O)O[C@@H]1O[C@H](CO[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Linarin (Buddleoside), isolated from the flower extract of Mentha arvensis, shows selective dose dependent inhibitory effect on acetylcholinesterase (AChE)[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 885.2±65.0 °C at 760 mmHg |
| Flash Point | 292.2±27.8 °C |
| Exact Mass | 592.179199 |
| PSA | 217.97000 |
| LogP | 2.10 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2~8°C |