Home
Products
(+)-Bicuculline
| Product Name | (+)-Bicuculline |
| Price: | $34 / 20mg |
| Catalog No.: | CN02157 |
| CAS No.: | 485-49-4 |
| Molecular Formula: | C20H17NO6 |
| Molecular Weight: | 367.36 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | White powder |
| Source: | The tubers of Corydalis ambigua |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CN1CCc2c([C@H]1[C@@H]1OC(=O)c3c1ccc1c3OCO1)cc1c(c2)OCO1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (+)-Bicuculline is a light-sensitive competitive antagonist of GABA-A receptor. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 542.3±50.0 °C at 760 mmHg |
| Flash Point | 281.8±30.1 °C |
| Exact Mass | 367.105591 |
| PSA | 66.46000 |
| LogP | 2.88 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |