Home
Products
N-Methylcytisine
| Product Name | N-Methylcytisine |
| Price: | $117 / 20mg |
| Catalog No.: | CN02150 |
| CAS No.: | 486-86-2 |
| Molecular Formula: | C12H16N2O |
| Molecular Weight: | 204.27 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | White cryst. |
| Source: | The roots of Sophora flavescens |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CN1C[C@@H]2C[C@H](C1)c1n(C2)c(=O)ccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | N-Methylcytisine (Caulophylline), a tricyclic quinolizidine alkaloid, exerts hypoglycaemic, analgesic and anti-inflammatory activities. N-methylcytisine is a selective ligand of nicotinic receptors of acetylcholine in the central nervous system and has a high affinity (Kd = 50 nM) to nicotinic acetylcholine receptors (nAChR) from squid optical ganglia[1][2]. |
| Target | kd: 50 nM (nicotinic acetylcholine receptors)[2] |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 400.8±34.0 °C at 760 mmHg |
| Flash Point | 191.9±18.0 °C |
| Exact Mass | 204.126266 |
| PSA | 25.24000 |
| LogP | 0.46 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |