Home
Products
Phytone
| Product Name | Phytone |
| Price: | $380 / 10mg |
| Catalog No.: | CN08705 |
| CAS No.: | 502-69-2 |
| Molecular Formula: | C18H36O |
| Molecular Weight: | 268.48 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Oil |
| Source: | The leaves of Black tea. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(CCCC(C)C)CCCC(CCCC(=O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hexahydrofarnesyl acetone (6,10,14-Trimethyl-2-pentadecanone), a sesquiterpene isolated from Launaea mucronata, is the major constituents of the essential oil. Hexahydrofarnesyl acetone has antibacterial, anti-nociceptive and anti-inflammation activities[1][2]. |
| Density | 0.8±0.1 g/cm3 |
| Boiling Point | 316.8±10.0 °C at 760 mmHg |
| Flash Point | 95.1±12.6 °C |
| Exact Mass | 268.276611 |
| PSA | 17.07000 |
| LogP | 7.26 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |