Home
Products
L-Hydroxyproline
| Product Name | L-Hydroxyproline |
| Price: | $15 / 20mg |
| Catalog No.: | CN00082 |
| CAS No.: | 51-35-4 |
| Molecular Formula: | C5H9NO3 |
| Molecular Weight: | 131.13 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1CN[C@@H](C1)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | L-Hydroxyproline, one of the hydroxyproline (Hyp) isomers, is a useful chiral building block in the production of many pharmaceuticals. |
| Target | Human Endogenous Metabolite |
| In Vitro | L-Hydroxyproline (Trans-4-hydroxy-L-proline;Trans-Hyp) has been widely used in medicine, biochemistry, food, cosmetic and other aspects of industry. Additionally, L-Hydroxyproline has also been found in the composition of some secondary metabolites such as actinomycins and echinocandins. L-Hydroxyproline is manufactured industrially most by acid hydrolysis of mammalian collagen because of its rich amount in the collagen[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 355.2±42.0 °C at 760 mmHg |
| Flash Point | 168.6±27.9 °C |
| Exact Mass | 131.058243 |
| PSA | 69.56000 |
| LogP | -1.84 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |