Home
Products
Echinocystic acid
| Product Name | Echinocystic acid |
| Price: | Inquiry |
| Catalog No.: | CN07918 |
| CAS No.: | 510-30-5 |
| Molecular Formula: | C30H48O4 |
| Molecular Weight: | 472.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The barks of Albizzia julibrissin Durazz. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1C[C@]2(C)C(=CC[C@H]3[C@@]2(C)CCC2[C@]3(C)CC[C@@H](C2(C)C)O)[C@@H]2[C@@]1(CCC(C2)(C)C)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Echinocystic acid a pentacyclic triterpene isolated from the fruits of Gleditsia sinensis Lam, has potent antioxidant, anti-inflammatory and anti-tumor properties. In vitro: Echinocystic acid (EA) inhibit the formation of osteoclast. EA inhibit RANKL-induced NF-κB activation and ERK phosphorylation in BMMs. [1] EA inhibit IL-1β-induced inflammation in chondrocytes. [2]In vivo: Echinocystic acid reduces reserpine-induced pain/depression dyad in mice. [3] |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 585.0±50.0 °C at 760 mmHg |
| Flash Point | 321.6±26.6 °C |
| Exact Mass | 472.355255 |
| PSA | 77.76000 |
| LogP | 7.58 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |
| Storage condition | 2-8C |