Home
Products
Taraxerone
| Product Name | Taraxerone |
| Price: | $321 / 10mg |
| Catalog No.: | CN07915 |
| CAS No.: | 514-07-8 |
| Molecular Formula: | C30H48O |
| Molecular Weight: | 424.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Taraxacum mongolicum Hand. Mazz. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1CCC2(C(C1(C)C)CCC1(C2CCC2(C1=CCC1(C2CC(C)(C)CC1)C)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Taraxerone is isolated from Sedum sarmentosum. Taraxerone enhances effects on alcohol dehydrogenase (ADH) and acetaldehyde dehydrogenase (ALDH) activities with EC50 values of 512.42 and 500.16 μM, respectively[1]. |
| Target | EC50: 512.42 μM (ADH); 500.16 μM (ALDH)[1] |
| In Vivo | Taraxerone significantly lowers the plasma alcohol and acetaldehyde concentrations in mice. Compare to the control group, the ADH and ALDH expressions in the liver tissues are abruptly increased in the taraxerone-treated groups after ethanol exposure[1]. Taraxerone prevents catalase, superoxide dismutase, and reduces glutathione concentrations from the decrease induced by ethanol administration[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 488.3±44.0 °C at 760 mmHg |
| Flash Point | 202.8±23.4 °C |
| Exact Mass | 424.370514 |
| PSA | 17.07000 |
| LogP | 10.48 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |