Home
Products
Sciadopitysin
| Product Name | Sciadopitysin |
| Price: | $190 / 10mg |
| Catalog No.: | CN05313 |
| CAS No.: | 521-34-6 |
| Molecular Formula: | C33H24O10 |
| Molecular Weight: | 580.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The leaves of Ginkgo biloba L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)c1cc(=O)c2c(o1)c(c(cc2O)O)c1cc(ccc1OC)c1cc(=O)c2c(o1)cc(cc2O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sciadopitysin is a type of biflavonoids in leaves from ginkgo biloba[1]. Sciadopitysi inhibits RANKL-induced osteoclastogenesis and bone loss by inhibiting NF-κB activation and reducing the expression of c-Fos and NFATc1[2]. |
| Target | NF-κB |
| In Vitro | Sciadopitysin (2.5, 5, 10 μM ) strongly reduces RANKL-induced osteoclast-specific genes expression, including cathepsin K (CTSK), tartrate-resistant acid phosphatase (TRAP) and MMP-9. Furthermore, Sciadopitysin apparently attenuates RANKL-increased expressions of c-Fos and NFATc1[2]. |
| In Vivo | Sciadopitysin (i.p.; 10 mg/kg; every other day for 8 days) can reverse the bone loss in LPS-induced mice model (C57BL/6 mice; 6 weeks old)[2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 839.6±65.0 °C at 760 mmHg |
| Flash Point | 276.2±27.8 °C |
| Exact Mass | 580.136963 |
| PSA | 148.80000 |
| LogP | 5.50 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |