Home
Products
Tetramethylcurcumin
| Product Name | Tetramethylcurcumin |
| Price: | $204 / 10mg |
| Catalog No.: | CN03767 |
| CAS No.: | 52328-97-9 |
| Molecular Formula: | C25H28O6 |
| Molecular Weight: | 424.49 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Curcuma rcenyujin |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(/C=C/C(=O)C(C(=O)/C=C/c2ccc(c(c2)OC)OC)(C)C)ccc1OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tetramethylcurcumin (FLLL31), derived from curcumin, specifically suppresses the phosphorylation of STAT3 by binding selectively to Janus kinase 2 and the STAT3 Src homology-2 domain. Tetramethylcurcumin exhibits anti-inflammatory and anti-cancer effects[1][2]. |
| Target | STAT3 |
| In Vitro | Tetramethylcurcumin (FLLL31; 2.5 and 5 µM; for 24 hours) downregulats STAT3 phosphorylation and DNA-binding activity in MDA-MB-231 breast and PANC-1 pancreatic cancer cells[1]. Tetramethylcurcumin inhibits cell viability, cell invasion. Tetramethylcurcumin is a effective inhibitor of STAT3 phosphorylation, DNA-binding activity, and transactivation in vitro, leading to the impediment of multiple oncogenic processes and the induction of apoptosis in pancreatic and breast cancer cell lines[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 594.5±50.0 °C at 760 mmHg |
| Flash Point | 255.1±30.2 °C |
| Exact Mass | 424.188599 |
| PSA | 71.06000 |
| LogP | 4.81 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |