Home
Products
Isobavachromene
| Product Name | Isobavachromene |
| Price: | Inquiry |
| Catalog No.: | CN05659 |
| CAS No.: | 52801-22-6 |
| Molecular Formula: | C20H18O4 |
| Molecular Weight: | 322.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Yellow powder |
| Source: | The seeds of Psoralea corylifolia L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)C=CC(=O)c1ccc2c(c1O)C=CC(O2)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isobavachromene is an antibacterial agent[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 535.1±50.0 °C at 760 mmHg |
| Flash Point | 193.7±23.6 °C |
| Exact Mass | 322.120514 |
| LogP | 5.99 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |