Home
Products
4-Methylesculetin
| Product Name | 4-Methylesculetin |
| Price: | $31 / 20mg |
| Catalog No.: | CN06063 |
| CAS No.: | 529-84-0 |
| Molecular Formula: | C10H8O4 |
| Molecular Weight: | 192.17 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The peels of Aesculus hippocastanum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1cc(C)c2c(o1)cc(c(c2)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 4-Methylesculetin is an orally active natural coumarin derivative, with potent anti-oxidant and anti-inflammatory activities. 4-Methylesculetin inhibits myeloperoxidase activity and reduces IL-6 level[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 455.5±45.0 °C at 760 mmHg |
| Flash Point | 190.8±22.2 °C |
| Exact Mass | 192.042252 |
| PSA | 70.67000 |
| LogP | 2.08 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Storage condition | 2-8°C |