Home
Products
Euscaphic acid
| Product Name | Euscaphic acid |
| Price: | $263 / 5mg |
| Catalog No.: | CN07911 |
| CAS No.: | 53155-25-2 |
| Molecular Formula: | C30H48O5 |
| Molecular Weight: | 488.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The dried fruit of Ziziphus jujuba. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1C[C@@]2(C)[C@H](C([C@@H]1O)(C)C)CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2[C@](C)(O)[C@H](C)CC1)C(=O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Euscaphic acid, a DNA polymerase inhibitor, is a triterpene from the root of the R. alceaefolius Poir. Euscaphic inhibits calf DNA polymerase α (pol α) and rat DNA polymerase β (pol β) with IC50 values of 61 and 108 μM[1]. Euscaphic acid induces apoptosis[2]. |
| Target | IC50: 61 μM (calf DNA polymerase α); 108 μM (rat DNA polymerase β)[1]; apoptosis[2] |
| In Vitro | Euscaphic acid induces apoptosis and cell cycle arrest in NPC cells by suppression of the PI3K/AKT/mTOR signaling pathway[2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 602.7±55.0 °C at 760 mmHg |
| Flash Point | 332.3±28.0 °C |
| Exact Mass | 488.350189 |
| PSA | 97.99000 |
| LogP | 6.21 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |