Home
Products
Protohypericin
| Product Name | Protohypericin |
| Price: | $293 / 10mg |
| Catalog No.: | CN05868 |
| CAS No.: | 548-03-8 |
| Molecular Formula: | C30H18O8 |
| Molecular Weight: | 506.46 g/mol |
| Purity: | >=98% |
| Type of Compound: | Quinones |
| Physical Desc.: | Powder |
| Source: | The herbs of Hypericum perforatum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Cc1cc(O)c2c(c1)c1c3c4cc(C)cc(c4cc4c3c(c3c1c(c2)c(O)cc3O)c(cc4O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Protohypericin is a naturally occurring naphthodianthrone derived from plant Hypericum perforatum. Radioiodinated protohypericin is used in Tumor necrosis targeted radiotherapy[1][2]. |
| Density | 1.736g/cm3 |
| Boiling Point | 954.3ºC at 760mmHg |
| Flash Point | 544.7ºC |
| Exact Mass | 476.12600 |
| PSA | 121.38000 |
| LogP | 6.89400 |